Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 212322-56-0, Name is Ethyl 3-(3-amino-4-(methylamino)-N-(pyridin-2-yl)benzamido)propanoate, SMILES is O=C(OCC)CCN(C1=NC=CC=C1)C(C2=CC=C(NC)C(N)=C2)=O, belongs to amides-buliding-blocks compound. In a document, author is Liu, Yang, introduce the new discover, Name: Ethyl 3-(3-amino-4-(methylamino)-N-(pyridin-2-yl)benzamido)propanoate.
Picolinamide-Based Iridium Catalysts for Dehydrogenation of Formic Acid in Water: Effect of Amide N Substituent on Activity and Stability
To develop highly efficient catalysts for dehydrogenation of formic acid in water, we investigated several Cp*Ir catalysts with various amide ligands. The catalyst with an N-phenylpicolinamide ligand exhibited a TOF of 118 000 h(-1) at 60 degrees C. A constant rate (TOF>35 000 h(-1)) was maintained for six hours, and a TON of 1 000 000 was achieved at 50 degrees C.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 212322-56-0 is helpful to your research. Name: Ethyl 3-(3-amino-4-(methylamino)-N-(pyridin-2-yl)benzamido)propanoate.