Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 71432-55-8, Name is tert-Butyl N,N’-diisopropylcarbamimidate, SMILES is CC(/N=C(OC(C)(C)C)/NC(C)C)C, belongs to amides-buliding-blocks compound. In a document, author is Leonard, Michael Z., introduce the new discover, Formula: C11H24N2O.
Thiocyanation of Enamines of the 3,3-Dialkyl-1,2,3,4-tetrahydroisoquinoline Series
Thiocyanation of secondary enamines of the 3,3-dialkyl-1,2,3,4-tetrahydroisoquinoline series and their benzo[f]-fused analogs (esters, amides, ketones, and nitriles) with thiocyanogen generated in situ afforded thiazolo[4,3-a]isoquinoline derivatives. Analogous reaction with a tertiary enamino ketone gave product of hydrogen substitution at the -carbon atom of the enamine fragment.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 71432-55-8 is helpful to your research. Formula: C11H24N2O.