Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, HPLC of Formula: C9H14N4O3, 305-84-0, Name is L-Carnosine, SMILES is OC([C@@H](NC(CCN)=O)CC1=CN=CN1)=O, belongs to amides-buliding-blocks compound. In a document, author is Csire, Gizella, introduce the new discover.
Hydride Amide and Hydride Phenolate Complexes of NHC Coordinated Aluminum
The reaction of NHC alane adducts NHC center dot AlH3 (NHC = N-Heterocyclic Carbene; NHC = iPr(2)Im, Dipp(2)Im; R(2)Im = 1,3-di-organyl-imidazolin-2-ylidene; iPr = isopropyl; Dipp = 2,6-diisopropylphenyl) with secondary amines HNR2 [R = iPr, Ph, Si(CH3)(3)] and the reaction of the trimethylamine alane adduct (NMe3)center dot AlH3 with secondary amines followed by the reaction with the NHC both lead to formation of the compounds NHC center dot AlH2(NR2) 1-6 [NHC = iPr(2)Im, Dipp(2)Im, R = iPr, Ph, Si(CH3)(3)]. These compounds are stable in solution up to temperatures of 90 degrees C. In contrast to the NHC alane adduct (iPr(2)Im)center dot AlH3 (I) and (Dipp(2)Im)center dot AlH3 (II), no ring expansion reaction to six-membered heterocyclic rings or ring opening reaction were observed for the reaction of (iPr(2)Im)center dot AlH2(NR2) with another equivalent of the NHCs iPr(2)Im or Dipp(2)Im. Thus, amide substituted NHC alane adducts show a much high stability compared to the parent compounds NHC center dot AlH3. Furthermore, the reaction of NHC center dot AlH3 (NHC = iPr(2)Im, Dipp(2)Im) with 2,4,6-trimethylphenol leads to the formation of the adducts NHC center dot AlH3-n(OMes)(n) 7-10 (n = 1, 2). The reaction with n >= 3 equivalent of 2,4,6-trimethylphenol afforded the imidazolium salt [Dipp(2)ImH](+)[Al(OMes)(4)](-) (11). The compounds 7-11 are also stable with respect to ring expansion after addition of another equivalent NHC.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 305-84-0. HPLC of Formula: C9H14N4O3.