Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, HPLC of Formula: C7H16ClNO2, 13404-22-3, Name is H-Ala-OtBu.HCl, SMILES is C[C@H](N)C(OC(C)(C)C)=O.[H]Cl, belongs to amides-buliding-blocks compound. In a document, author is Chunhai Li, introduce the new discover.
Copper-catalyzed three-component reaction for the synthesis of fluoroalkoxyl imidates
A Cu-catalyzed three-component reaction of aromatic terminal alkynes with aryl sulfonyl azides and primary fluoroalkyl alcohols for the synthesis of fluoroalkoxyl imidates was developed. This simple method enabled the efficient synthesis of trifluoroethoxyl, pentafluoropropoxyl, and heptafluorobutoxyl imidates in good to excellent yields under mild reaction conditions with excellent functional group tolerance. (C) 2018 Elsevier Ltd. All rights reserved.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 13404-22-3. HPLC of Formula: C7H16ClNO2.