Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, Recommanded Product: (S)-2-Amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid, 25197-96-0, Name is (S)-2-Amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid, SMILES is O=C(O)[C@@H](N)CC1=CNC2=C1C=C(OC)C=C2, belongs to amides-buliding-blocks compound. In a document, author is Fiuza, Thiago, introduce the new discover.
Direct amide synthesis via Ni-mediated aminocarbonylation of arylboronic acids with CO and nitroarenes
Herein we describe an alternative and unconventional approach of an aminocarbonylation reaction to access aryl amides from readily available and low-cost arylboronic acids and nitroarenes. Nickel metal can serve as both reductant and catalyst in this direct aminocarbonylation. This protocol exhibits a good functional group compatibility and allows a variety of aryl amides to be synthesized, including several drug-like molecules.
A reaction mechanism is the microscopic path by which reactants are transformed into products. Each step is an elementary reaction. In my other articles, you can also check out more blogs about 25197-96-0. Recommanded Product: (S)-2-Amino-3-(5-methoxy-1H-indol-3-yl)propanoic acid.